C16H19N — CID 66647094
benzene;1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 66647094) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is benzene;1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | benzene;1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 66647094 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | benzene;1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | NC1CCc2ccccc2C1.c1ccccc1 |
| InChI | InChI=1S/C10H13N.C6H6/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-4-6-5-3-1/h1-4,10H,5-7,11H2;1-6H |
| InChIKey | HEPSPENIXHTMEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |