C10H13N — CID 7058074
(1S)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 7058074) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (1S)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 7058074 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (1S)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2/t10-/m0/s1 |
| InChIKey | JRZGPXSSNPTNMA-JTQLQIEISA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |