C11H16N2 — CID 107126485
1,2,3,4-tetrahydronaphthalen-2-ylmethylhydrazine (PubChem CID 107126485) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-ylmethylhydrazine.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-ylmethylhydrazine |
|---|---|
| PubChem CID | 107126485 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-ylmethylhydrazine |
| SMILES | NNCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H16N2/c12-13-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,9,13H,5-8,12H2 |
| InChIKey | ALXVAVDYGLUVMH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|