C10H14N2O — CID 63589103
3,4-dihydro-2H-chromen-3-ylmethylhydrazine (PubChem CID 63589103) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-3-ylmethylhydrazine.
| Compound Name | 3,4-dihydro-2H-chromen-3-ylmethylhydrazine |
|---|---|
| PubChem CID | 63589103 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3,4-dihydro-2H-chromen-3-ylmethylhydrazine |
| SMILES | NNCC1COc2ccccc2C1 |
| InChI | InChI=1S/C10H14N2O/c11-12-6-8-5-9-3-1-2-4-10(9)13-7-8/h1-4,8,12H,5-7,11H2 |
| InChIKey | LFLMDGFSRPZXPF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|