C14H22N2O3S — CID 94201312
(3S)-3-[(diethylsulfamoylamino)methyl]-3,4-dihydro-2H-chromene (PubChem CID 94201312) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is (3S)-3-[(diethylsulfamoylamino)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | (3S)-3-[(diethylsulfamoylamino)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 94201312 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3S)-3-[(diethylsulfamoylamino)methyl]-3,4-dihydro-2H-chromene |
| SMILES | CCN(CC)S(=O)(=O)NC[C@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-16(4-2)20(17,18)15-10-12-9-13-7-5-6-8-14(13)19-11-12/h5-8,12,15H,3-4,9-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | VBMKCMUDBLLTBR-LBPRGKRZSA-N |
| XLogP | 1.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |