C16H15F2NO3S — CID 51238121
N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,5-difluorobenzenesulfonamide (PubChem CID 51238121) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,5-difluorobenzenesulfonamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 51238121 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1COc2ccccc2C1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15F2NO3S/c17-13-6-14(18)8-15(7-13)23(20,21)19-9-11-5-12-3-1-2-4-16(12)22-10-11/h1-4,6-8,11,19H,5,9-10H2 |
| InChIKey | KSUFZHAKRWRDLW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |