C16H24 — CID 102001272
2-(4-methylpentyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 102001272) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-(4-methylpentyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-methylpentyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 102001272 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(4-methylpentyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)CCCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H24/c1-13(2)6-5-7-14-10-11-15-8-3-4-9-16(15)12-14/h3-4,8-9,13-14H,5-7,10-12H2,1-2H3 |
| InChIKey | QWFRIFIGFCZQOD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |