C15H22 — CID 14298811
2-pentyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 14298811) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-pentyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-pentyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 14298811 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-pentyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H22/c1-2-3-4-7-13-10-11-14-8-5-6-9-15(14)12-13/h5-6,8-9,13H,2-4,7,10-12H2,1H3 |
| InChIKey | NRFCKFIKYUTXGZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|