C15H20O — CID 173213584
[(8Z)-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl]methanol (PubChem CID 173213584) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is [(8Z)-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl]methanol.
| Compound Name | [(8Z)-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl]methanol |
|---|---|
| PubChem CID | 173213584 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [(8Z)-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl]methanol |
| SMILES | OCC1C/C=C\CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H20O/c16-12-13-7-3-1-2-4-8-14-9-5-6-10-15(14)11-13/h1,3,5-6,9-10,13,16H,2,4,7-8,11-12H2/b3-1- |
| InChIKey | IKESAMVKNPNMIU-IWQZZHSRSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|