C13H16 — CID 102598891
(7E)-6,9,10,11-tetrahydro-5H-benzo[9]annulene (PubChem CID 102598891) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (7E)-6,9,10,11-tetrahydro-5H-benzo[9]annulene.
| Compound Name | (7E)-6,9,10,11-tetrahydro-5H-benzo[9]annulene |
|---|---|
| PubChem CID | 102598891 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (7E)-6,9,10,11-tetrahydro-5H-benzo[9]annulene |
| SMILES | C1=C/CCc2ccccc2CCC/1 |
| InChI | InChI=1S/C13H16/c1-2-4-8-12-10-6-7-11-13(12)9-5-3-1/h1-2,6-7,10-11H,3-5,8-9H2/b2-1+ |
| InChIKey | GUCGRUQFGKZUKH-OWOJBTEDSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|