C16H20O — CID 173213706
(8Z)-6-(methoxymethylidene)-7,10,11,12-tetrahydro-5H-benzo[10]annulene (PubChem CID 173213706) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (8Z)-6-(methoxymethylidene)-7,10,11,12-tetrahydro-5H-benzo[10]annulene.
| Compound Name | (8Z)-6-(methoxymethylidene)-7,10,11,12-tetrahydro-5H-benzo[10]annulene |
|---|---|
| PubChem CID | 173213706 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (8Z)-6-(methoxymethylidene)-7,10,11,12-tetrahydro-5H-benzo[10]annulene |
| SMILES | COC=C1C/C=C\CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H20O/c1-17-13-14-8-4-2-3-5-9-15-10-6-7-11-16(15)12-14/h2,4,6-7,10-11,13H,3,5,8-9,12H2,1H3/b4-2-,14-13? |
| InChIKey | TUCKFOLVIVLDAL-HXIVJMAJSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|