C18H26 — CID 166550494
1,2,3,3a,4,5,6,6a-octahydropentalene;1,2,3,4-tetrahydronaphthalene (PubChem CID 166550494) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalene;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 166550494 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;1,2,3,4-tetrahydronaphthalene |
| SMILES | C1CC2CCCC2C1.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.C8H14/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-7-5-2-6-8(7)4-1/h1-2,5-6H,3-4,7-8H2;7-8H,1-6H2 |
| InChIKey | ILDRFSTVFPEBJS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |