C19H24 — CID 159909847
2,3,3a,4,5,6,7,7a-octahydro-1H-indene;naphthalene (PubChem CID 159909847) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;naphthalene.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;naphthalene |
|---|---|
| PubChem CID | 159909847 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;naphthalene |
| SMILES | C1CCC2CCCC2C1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H16/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-5-9-7-3-6-8(9)4-1/h1-8H;8-9H,1-7H2 |
| InChIKey | NXAWSNVYKJSISM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |