About benzene;cyclohexylcyclohexane
benzene;cyclohexylcyclohexane (PubChem CID 160520949) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is benzene;cyclohexylcyclohexane.
Molecular Properties
| Compound Name | benzene;cyclohexylcyclohexane |
| PubChem CID | 160520949 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | benzene;cyclohexylcyclohexane |
| SMILES | C1CCC(C2CCCCC2)CC1.c1ccccc1 |
| InChI | InChI=1S/C12H22.C6H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-6H |
| InChIKey | QUGIQGHHMKMAFN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;cyclohexylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;cyclohexylcyclohexane?
The IUPAC name of benzene;cyclohexylcyclohexane (CID 160520949) is benzene;cyclohexylcyclohexane.
What is the SMILES notation for benzene;cyclohexylcyclohexane?
The canonical SMILES for benzene;cyclohexylcyclohexane is C1CCC(C2CCCCC2)CC1.c1ccccc1.
What is the InChIKey of benzene;cyclohexylcyclohexane?
The InChIKey is QUGIQGHHMKMAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22.C6H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-5-3-1/h11-12H,1-10H2;1-6H.
What are the key properties of benzene;cyclohexylcyclohexane?
benzene;cyclohexylcyclohexane has a molecular weight of 244.42 g/mol, XLogP of 5.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;cyclohexylcyclohexane is sourced from PubChem (CID 160520949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).