About azane;cyclohexylcyclohexane
azane;cyclohexylcyclohexane (PubChem CID 66583255) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is azane;cyclohexylcyclohexane.
Molecular Properties
| Compound Name | azane;cyclohexylcyclohexane |
| PubChem CID | 66583255 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | azane;cyclohexylcyclohexane |
| SMILES | C1CCC(C2CCCCC2)CC1.N |
| InChI | InChI=1S/C12H22.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h11-12H,1-10H2;1H3 |
| InChIKey | MFWUCNVQXLSAKT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;cyclohexylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;cyclohexylcyclohexane?
The IUPAC name of azane;cyclohexylcyclohexane (CID 66583255) is azane;cyclohexylcyclohexane.
What is the SMILES notation for azane;cyclohexylcyclohexane?
The canonical SMILES for azane;cyclohexylcyclohexane is C1CCC(C2CCCCC2)CC1.N.
What is the InChIKey of azane;cyclohexylcyclohexane?
The InChIKey is MFWUCNVQXLSAKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h11-12H,1-10H2;1H3.
What are the key properties of azane;cyclohexylcyclohexane?
azane;cyclohexylcyclohexane has a molecular weight of 183.34 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;cyclohexylcyclohexane is sourced from PubChem (CID 66583255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).