C10H20Pb — CID 173135911
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;λ2-plumbane (PubChem CID 173135911) has the molecular formula C10H20Pb and a molecular weight of 347.47 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;λ2-plumbane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;λ2-plumbane |
|---|---|
| PubChem CID | 173135911 |
| Molecular Formula | C10H20Pb |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;λ2-plumbane |
| SMILES | C1CCC2CCCCC2C1.[PbH2] |
| InChI | InChI=1S/C10H18.Pb.2H/c1-2-6-10-8-4-3-7-9(10)5-1;;;/h9-10H,1-8H2;;; |
| InChIKey | QENCOTAUXLVJMW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |