About cyclohexylcycloheptane
cyclohexylcycloheptane (PubChem CID 524589) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is cyclohexylcycloheptane.
Molecular Properties
| Compound Name | cyclohexylcycloheptane |
| PubChem CID | 524589 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | cyclohexylcycloheptane |
| SMILES | C1CCCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C13H24/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-13/h12-13H,1-11H2 |
| InChIKey | GIFFMLIGKIVECO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclohexylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylcycloheptane?
The IUPAC name of cyclohexylcycloheptane (CID 524589) is cyclohexylcycloheptane.
What is the SMILES notation for cyclohexylcycloheptane?
The canonical SMILES for cyclohexylcycloheptane is C1CCCC(C2CCCCC2)CC1.
What is the InChIKey of cyclohexylcycloheptane?
The InChIKey is GIFFMLIGKIVECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-13/h12-13H,1-11H2.
What are the key properties of cyclohexylcycloheptane?
cyclohexylcycloheptane has a molecular weight of 180.33 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylcycloheptane is sourced from PubChem (CID 524589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).