About CID 175877016
CID 175877016 (PubChem CID 175877016) has the molecular formula C10H18Ca
and a molecular weight of 178.33 g/mol.
Molecular Properties
| Compound Name | CID 175877016 |
| PubChem CID | 175877016 |
| Molecular Formula | C10H18Ca |
| Molecular Weight | 178.33 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | — |
| SMILES | C1CCC2CCCCC2C1.[Ca] |
| InChI | InChI=1S/C10H18.Ca/c1-2-6-10-8-4-3-7-9(10)5-1;/h9-10H,1-8H2; |
| InChIKey | ZTRQJUAHMZGVCK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 175877016 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175877016?
The IUPAC name of CID 175877016 (CID 175877016) is not available.
What is the SMILES notation for CID 175877016?
The canonical SMILES for CID 175877016 is C1CCC2CCCCC2C1.[Ca].
What is the InChIKey of CID 175877016?
The InChIKey is ZTRQJUAHMZGVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.Ca/c1-2-6-10-8-4-3-7-9(10)5-1;/h9-10H,1-8H2;.
What are the key properties of CID 175877016?
CID 175877016 has a molecular weight of 178.33 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175877016 is sourced from PubChem (CID 175877016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).