C16H28 — CID 154595560
tricyclo[11.3.0.05,9]hexadecane (PubChem CID 154595560) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is tricyclo[11.3.0.05,9]hexadecane.
| Compound Name | tricyclo[11.3.0.05,9]hexadecane |
|---|---|
| PubChem CID | 154595560 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | tricyclo[11.3.0.05,9]hexadecane |
| SMILES | C1CC2CCCC3CCCC3CCCC2C1 |
| InChI | InChI=1S/C16H28/c1-5-13-9-3-11-15-7-2-8-16(15)12-4-10-14(13)6-1/h13-16H,1-12H2 |
| InChIKey | RPTFRTBCZZOSOK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |