C8H17P — CID 174450452
1,2,3,3a,4,5,6,6a-octahydropentalene;phosphane (PubChem CID 174450452) has the molecular formula C8H17P and a molecular weight of 144.20 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalene;phosphane.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;phosphane |
|---|---|
| PubChem CID | 174450452 |
| Molecular Formula | C8H17P |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;phosphane |
| SMILES | C1CC2CCCC2C1.P |
| InChI | InChI=1S/C8H14.H3P/c1-3-7-5-2-6-8(7)4-1;/h7-8H,1-6H2;1H3 |
| InChIKey | VLYIOKYDOOFUDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|