C21H48 — CID 161297906
1,2,3,3a,4,5,6,6a-octahydropentalene;cyclopentane;ethane (PubChem CID 161297906) has the molecular formula C21H48 and a molecular weight of 300.62 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalene;cyclopentane;ethane.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;cyclopentane;ethane |
|---|---|
| PubChem CID | 161297906 |
| Molecular Formula | C21H48 |
| Molecular Weight | 300.62 g/mol |
| Exact Mass | 300.38 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalene;cyclopentane;ethane |
| SMILES | C1CC2CCCC2C1.C1CCCC1.CC.CC.CC.CC |
| InChI | InChI=1S/C8H14.C5H10.4C2H6/c1-3-7-5-2-6-8(7)4-1;1-2-4-5-3-1;4*1-2/h7-8H,1-6H2;1-5H2;4*1-2H3 |
| InChIKey | VHFIQUJMTMXDOU-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.62 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |