About 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane)
1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) (PubChem CID 159863371) has the molecular formula C36H74
and a molecular weight of 506.99 g/mol. Its IUPAC name is 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane).
Molecular Properties
| Compound Name | 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) |
| PubChem CID | 159863371 |
| Molecular Formula | C36H74 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.58 |
| IUPAC Name | 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) |
| SMILES | CC.CC.CC1CCCC(C2CCCC2)CCC1.CC1CCCCCCC1.CC1CCCCCCC1 |
| InChI | InChI=1S/C14H26.2C9H18.2C2H6/c1-12-6-4-10-14(11-5-7-12)13-8-2-3-9-13;2*1-9-7-5-3-2-4-6-8-9;2*1-2/h12-14H,2-11H2,1H3;2*9H,2-8H2,1H3;2*1-2H3 |
| InChIKey | NRKTUIMPKFNPPX-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane)?
The IUPAC name of 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) (CID 159863371) is 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane).
What is the SMILES notation for 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane)?
The canonical SMILES for 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) is CC.CC.CC1CCCC(C2CCCC2)CCC1.CC1CCCCCCC1.CC1CCCCCCC1.
What is the InChIKey of 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane)?
The InChIKey is NRKTUIMPKFNPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26.2C9H18.2C2H6/c1-12-6-4-10-14(11-5-7-12)13-8-2-3-9-13;2*1-9-7-5-3-2-4-6-8-9;2*1-2/h12-14H,2-11H2,1H3;2*9H,2-8H2,1H3;2*1-2H3.
What are the key properties of 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane)?
1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) has a molecular weight of 506.99 g/mol, XLogP of 13.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-5-methylcyclooctane;ethane;bis(methylcyclooctane) is sourced from PubChem (CID 159863371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).