C17H32 — CID 158943908
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;methylcyclohexane (PubChem CID 158943908) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;methylcyclohexane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;methylcyclohexane |
|---|---|
| PubChem CID | 158943908 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;methylcyclohexane |
| SMILES | C1CCC2CCCCC2C1.CC1CCCCC1 |
| InChI | InChI=1S/C10H18.C7H14/c1-2-6-10-8-4-3-7-9(10)5-1;1-7-5-3-2-4-6-7/h9-10H,1-8H2;7H,2-6H2,1H3 |
| InChIKey | JKOYERGQUSURQE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |