About cyclopentylcyclopentane;phosphane
cyclopentylcyclopentane;phosphane (PubChem CID 174792657) has the molecular formula C10H21P
and a molecular weight of 172.25 g/mol. Its IUPAC name is cyclopentylcyclopentane;phosphane.
Molecular Properties
| Compound Name | cyclopentylcyclopentane;phosphane |
| PubChem CID | 174792657 |
| Molecular Formula | C10H21P |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | cyclopentylcyclopentane;phosphane |
| SMILES | C1CCC(C2CCCC2)C1.P |
| InChI | InChI=1S/C10H18.H3P/c1-2-6-9(5-1)10-7-3-4-8-10;/h9-10H,1-8H2;1H3 |
| InChIKey | QXNHRUJKNPEEFB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylcyclopentane;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylcyclopentane;phosphane?
The IUPAC name of cyclopentylcyclopentane;phosphane (CID 174792657) is cyclopentylcyclopentane;phosphane.
What is the SMILES notation for cyclopentylcyclopentane;phosphane?
The canonical SMILES for cyclopentylcyclopentane;phosphane is C1CCC(C2CCCC2)C1.P.
What is the InChIKey of cyclopentylcyclopentane;phosphane?
The InChIKey is QXNHRUJKNPEEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.H3P/c1-2-6-9(5-1)10-7-3-4-8-10;/h9-10H,1-8H2;1H3.
What are the key properties of cyclopentylcyclopentane;phosphane?
cyclopentylcyclopentane;phosphane has a molecular weight of 172.25 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylcyclopentane;phosphane is sourced from PubChem (CID 174792657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).