C13H20O — CID 142999040
ethane;[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]methanol (PubChem CID 142999040) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane;[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]methanol.
| Compound Name | ethane;[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]methanol |
|---|---|
| PubChem CID | 142999040 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane;[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]methanol |
| SMILES | CC.CC1Cc2ccccc2[C@H]1CO |
| InChI | InChI=1S/C11H14O.C2H6/c1-8-6-9-4-2-3-5-10(9)11(8)7-12;1-2/h2-5,8,11-12H,6-7H2,1H3;1-2H3/t8?,11-;/m0./s1 |
| InChIKey | VWWMUMRVSKEVOT-YCFJOMISSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |