C11H14O — CID 6429796
(1S,3S)-1,3-dimethyl-3,4-dihydro-1H-isochromene (PubChem CID 6429796) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (1S,3S)-1,3-dimethyl-3,4-dihydro-1H-isochromene.
| Compound Name | (1S,3S)-1,3-dimethyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 6429796 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1S,3S)-1,3-dimethyl-3,4-dihydro-1H-isochromene |
| SMILES | C[C@@H]1O[C@@H](C)Cc2ccccc21 |
| InChI | InChI=1S/C11H14O/c1-8-7-10-5-3-4-6-11(10)9(2)12-8/h3-6,8-9H,7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | AIODYCJUHTYCEB-IUCAKERBSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |