C11H11NS — CID 87711525
1-isothiocyanato-2-methyl-2,3-dihydro-1H-indene (PubChem CID 87711525) has the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. Its IUPAC name is 1-isothiocyanato-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 1-isothiocyanato-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 87711525 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1-isothiocyanato-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2ccccc2C1N=C=S |
| InChI | InChI=1S/C11H11NS/c1-8-6-9-4-2-3-5-10(9)11(8)12-7-13/h2-5,8,11H,6H2,1H3 |
| InChIKey | OGJYSQWTIBADRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|