C10H12N2 — CID 64985525
N'-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide (PubChem CID 64985525) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N'-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide.
| Compound Name | N'-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide |
|---|---|
| PubChem CID | 64985525 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N'-methylbicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide |
| SMILES | C/N=C(\N)C1Cc2ccccc21 |
| InChI | InChI=1S/C10H12N2/c1-12-10(11)9-6-7-4-2-3-5-8(7)9/h2-5,9H,6H2,1H3,(H2,11,12) |
| InChIKey | UOKLHNGMXIXCAN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|