About bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride
bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride (PubChem CID 71758321) has the molecular formula C9H11ClN2
and a molecular weight of 182.65 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride |
| PubChem CID | 71758321 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C1Cc2ccccc21 |
| InChI | InChI=1S/C9H10N2.ClH/c10-9(11)8-5-6-3-1-2-4-7(6)8;/h1-4,8H,5H2,(H3,10,11);1H |
| InChIKey | YGNFEAHTQCSVRL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride?
The IUPAC name of bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride (CID 71758321) is bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride.
What is the SMILES notation for bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride?
The canonical SMILES for bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)C1Cc2ccccc21.
What is the InChIKey of bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride?
The InChIKey is YGNFEAHTQCSVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.ClH/c10-9(11)8-5-6-3-1-2-4-7(6)8;/h1-4,8H,5H2,(H3,10,11);1H.
What are the key properties of bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride?
bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride has a molecular weight of 182.65 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride is sourced from PubChem (CID 71758321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).