C9H11ClN2 — CID 71758321
bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride (PubChem CID 71758321) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 71758321 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene-7-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C1Cc2ccccc21 |
| InChI | InChI=1S/C9H10N2.ClH/c10-9(11)8-5-6-3-1-2-4-7(6)8;/h1-4,8H,5H2,(H3,10,11);1H |
| InChIKey | YGNFEAHTQCSVRL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|