C10H14N3+ — CID 152773809
carbamimidoyl(2,3-dihydro-1H-inden-2-yl)azanium (PubChem CID 152773809) has the molecular formula C10H14N3+ and a molecular weight of 176.24 g/mol. Its IUPAC name is carbamimidoyl(2,3-dihydro-1H-inden-2-yl)azanium.
| Compound Name | carbamimidoyl(2,3-dihydro-1H-inden-2-yl)azanium |
|---|---|
| PubChem CID | 152773809 |
| Molecular Formula | C10H14N3+ |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | carbamimidoyl(2,3-dihydro-1H-inden-2-yl)azanium |
| SMILES | [H]/N=C(\N)[NH2+]C1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H13N3/c11-10(12)13-9-5-7-3-1-2-4-8(7)6-9/h1-4,9H,5-6H2,(H4,11,12,13)/p+1 |
| InChIKey | DKESMSIFJDXVCT-UHFFFAOYSA-O |
| XLogP | -0.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|