C14H20N2 — CID 65406240
N'-tert-butyl-2,3-dihydro-1H-indene-2-carboximidamide (PubChem CID 65406240) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N'-tert-butyl-2,3-dihydro-1H-indene-2-carboximidamide.
| Compound Name | N'-tert-butyl-2,3-dihydro-1H-indene-2-carboximidamide |
|---|---|
| PubChem CID | 65406240 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N'-tert-butyl-2,3-dihydro-1H-indene-2-carboximidamide |
| SMILES | CC(C)(C)/N=C(\N)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H20N2/c1-14(2,3)16-13(15)12-8-10-6-4-5-7-11(10)9-12/h4-7,12H,8-9H2,1-3H3,(H2,15,16) |
| InChIKey | HWSRFGHHXLMIDQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|