C12H13NO — CID 71439719
N-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(cyclopropyl)methylidene]hydroxylamine (PubChem CID 71439719) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is N-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(cyclopropyl)methylidene]hydroxylamine.
| Compound Name | N-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(cyclopropyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 71439719 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(cyclopropyl)methylidene]hydroxylamine |
| SMILES | ON=C(C1CC1)C1Cc2ccccc21 |
| InChI | InChI=1S/C12H13NO/c14-13-12(8-5-6-8)11-7-9-3-1-2-4-10(9)11/h1-4,8,11,14H,5-7H2 |
| InChIKey | OVBGYTVEUXRMJL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|