C13H11CrFO3 — CID 11087375
carbon monoxide;chromium;(1R,2R)-1-fluoro-2-methyl-2,3-dihydro-1H-indene (PubChem CID 11087375) has the molecular formula C13H11CrFO3 and a molecular weight of 286.22 g/mol. Its IUPAC name is carbon monoxide;chromium;(1R,2R)-1-fluoro-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | carbon monoxide;chromium;(1R,2R)-1-fluoro-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 11087375 |
| Molecular Formula | C13H11CrFO3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | carbon monoxide;chromium;(1R,2R)-1-fluoro-2-methyl-2,3-dihydro-1H-indene |
| SMILES | C[C@@H]1Cc2ccccc2[C@@H]1F.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C10H11F.3CO.Cr/c1-7-6-8-4-2-3-5-9(8)10(7)11;3*1-2;/h2-5,7,10H,6H2,1H3;;;;/t7-,10-;;;;/m1..../s1 |
| InChIKey | MAHLMDUSAZOOES-BVIKZGIMSA-N |
| XLogP | 2.77 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|