C9H10FN — CID 143629667
(2S)-1-fluoro-2,3-dihydro-1H-inden-2-amine (PubChem CID 143629667) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is (2S)-1-fluoro-2,3-dihydro-1H-inden-2-amine.
| Compound Name | (2S)-1-fluoro-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 143629667 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (2S)-1-fluoro-2,3-dihydro-1H-inden-2-amine |
| SMILES | N[C@H]1Cc2ccccc2C1F |
| InChI | InChI=1S/C9H10FN/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9H,5,11H2/t8-,9?/m0/s1 |
| InChIKey | HERCDUGUQUZBFE-IENPIDJESA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |