About (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine
(2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine (PubChem CID 66961474) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine.
Molecular Properties
| Compound Name | (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine |
| PubChem CID | 66961474 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine |
| SMILES | NCC1c2ccccc2CC1F |
| InChI | InChI=1S/C10H12FN/c11-10-5-7-3-1-2-4-8(7)9(10)6-12/h1-4,9-10H,5-6,12H2 |
| InChIKey | LMGGBORZAFIWPH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine?
The IUPAC name of (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine (CID 66961474) is (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine.
What is the SMILES notation for (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine?
The canonical SMILES for (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine is NCC1c2ccccc2CC1F.
What is the InChIKey of (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine?
The InChIKey is LMGGBORZAFIWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN/c11-10-5-7-3-1-2-4-8(7)9(10)6-12/h1-4,9-10H,5-6,12H2.
What are the key properties of (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine?
(2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine has a molecular weight of 165.21 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine is sourced from PubChem (CID 66961474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).