C13H20N2 — CID 141206347
1-(aminomethyl)-N-propyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 141206347) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-(aminomethyl)-N-propyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 1-(aminomethyl)-N-propyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 141206347 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-(aminomethyl)-N-propyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCNC1Cc2ccccc2C1CN |
| InChI | InChI=1S/C13H20N2/c1-2-7-15-13-8-10-5-3-4-6-11(10)12(13)9-14/h3-6,12-13,15H,2,7-9,14H2,1H3 |
| InChIKey | TYNLQUWEWPMRPW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |