C19H22IN — CID 65477430
2-[(4-iodophenyl)methyl]-N-propyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 65477430) has the molecular formula C19H22IN and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methyl]-N-propyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-[(4-iodophenyl)methyl]-N-propyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 65477430 |
| Molecular Formula | C19H22IN |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[(4-iodophenyl)methyl]-N-propyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1c2ccccc2CC1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C19H22IN/c1-2-11-21-19-16(12-14-7-9-17(20)10-8-14)13-15-5-3-4-6-18(15)19/h3-10,16,19,21H,2,11-13H2,1H3 |
| InChIKey | ARAMIAMRIANRJT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|