C14H21NO — CID 99831571
(1R,2S)-2-(3-methylbutylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 99831571) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1R,2S)-2-(3-methylbutylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2S)-2-(3-methylbutylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 99831571 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1R,2S)-2-(3-methylbutylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)CCN[C@H]1Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C14H21NO/c1-10(2)7-8-15-13-9-11-5-3-4-6-12(11)14(13)16/h3-6,10,13-16H,7-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | OWNKLZVDRKSERM-UONOGXRCSA-N |
| XLogP | 2.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |