C17H25NO — CID 76775232
2-(cycloheptylmethylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 76775232) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(cycloheptylmethylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(cycloheptylmethylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 76775232 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(cycloheptylmethylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1c2ccccc2CC1NCC1CCCCCC1 |
| InChI | InChI=1S/C17H25NO/c19-17-15-10-6-5-9-14(15)11-16(17)18-12-13-7-3-1-2-4-8-13/h5-6,9-10,13,16-19H,1-4,7-8,11-12H2 |
| InChIKey | BBOABNVUVYAQFP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |