C19H21N — CID 62921103
N-(cyclobutylmethyl)-9,10-dihydroanthracen-9-amine (PubChem CID 62921103) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-9,10-dihydroanthracen-9-amine.
| Compound Name | N-(cyclobutylmethyl)-9,10-dihydroanthracen-9-amine |
|---|---|
| PubChem CID | 62921103 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(cyclobutylmethyl)-9,10-dihydroanthracen-9-amine |
| SMILES | c1ccc2c(c1)Cc1ccccc1C2NCC1CCC1 |
| InChI | InChI=1S/C19H21N/c1-3-10-17-15(8-1)12-16-9-2-4-11-18(16)19(17)20-13-14-6-5-7-14/h1-4,8-11,14,19-20H,5-7,12-13H2 |
| InChIKey | DXSXVPWSLIGKSX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |