About N-prop-2-enyl-9,10-dihydroanthracen-9-amine
N-prop-2-enyl-9,10-dihydroanthracen-9-amine (PubChem CID 62919908) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-prop-2-enyl-9,10-dihydroanthracen-9-amine.
Molecular Properties
| Compound Name | N-prop-2-enyl-9,10-dihydroanthracen-9-amine |
| PubChem CID | 62919908 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-prop-2-enyl-9,10-dihydroanthracen-9-amine |
| SMILES | C=CCNC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H17N/c1-2-11-18-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17/h2-10,17-18H,1,11-12H2 |
| InChIKey | JTPFBVJHITVDQS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-9,10-dihydroanthracen-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-9,10-dihydroanthracen-9-amine?
The IUPAC name of N-prop-2-enyl-9,10-dihydroanthracen-9-amine (CID 62919908) is N-prop-2-enyl-9,10-dihydroanthracen-9-amine.
What is the SMILES notation for N-prop-2-enyl-9,10-dihydroanthracen-9-amine?
The canonical SMILES for N-prop-2-enyl-9,10-dihydroanthracen-9-amine is C=CCNC1c2ccccc2Cc2ccccc21.
What is the InChIKey of N-prop-2-enyl-9,10-dihydroanthracen-9-amine?
The InChIKey is JTPFBVJHITVDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-2-11-18-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17/h2-10,17-18H,1,11-12H2.
What are the key properties of N-prop-2-enyl-9,10-dihydroanthracen-9-amine?
N-prop-2-enyl-9,10-dihydroanthracen-9-amine has a molecular weight of 235.33 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-9,10-dihydroanthracen-9-amine is sourced from PubChem (CID 62919908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).