C17H17N — CID 62919908
N-prop-2-enyl-9,10-dihydroanthracen-9-amine (PubChem CID 62919908) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is N-prop-2-enyl-9,10-dihydroanthracen-9-amine.
| Compound Name | N-prop-2-enyl-9,10-dihydroanthracen-9-amine |
|---|---|
| PubChem CID | 62919908 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-prop-2-enyl-9,10-dihydroanthracen-9-amine |
| SMILES | C=CCNC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H17N/c1-2-11-18-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17/h2-10,17-18H,1,11-12H2 |
| InChIKey | JTPFBVJHITVDQS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|