C17H20N2 — CID 55131389
N'-(9,10-dihydroanthracen-9-yl)propane-1,3-diamine (PubChem CID 55131389) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N'-(9,10-dihydroanthracen-9-yl)propane-1,3-diamine.
| Compound Name | N'-(9,10-dihydroanthracen-9-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 55131389 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N'-(9,10-dihydroanthracen-9-yl)propane-1,3-diamine |
| SMILES | NCCCNC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H20N2/c18-10-5-11-19-17-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)17/h1-4,6-9,17,19H,5,10-12,18H2 |
| InChIKey | QCGXIDNYYJBQDT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|