About 9H-fluorene;hexane-1,6-diamine
9H-fluorene;hexane-1,6-diamine (PubChem CID 19108206) has the molecular formula C19H26N2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 9H-fluorene;hexane-1,6-diamine.
Molecular Properties
| Compound Name | 9H-fluorene;hexane-1,6-diamine |
| PubChem CID | 19108206 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 9H-fluorene;hexane-1,6-diamine |
| SMILES | NCCCCCCN.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C6H16N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;7-5-3-1-2-4-6-8/h1-8H,9H2;1-8H2 |
| InChIKey | MQFGUSXTVQNNNH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;hexane-1,6-diamine?
The IUPAC name of 9H-fluorene;hexane-1,6-diamine (CID 19108206) is 9H-fluorene;hexane-1,6-diamine.
What is the SMILES notation for 9H-fluorene;hexane-1,6-diamine?
The canonical SMILES for 9H-fluorene;hexane-1,6-diamine is NCCCCCCN.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;hexane-1,6-diamine?
The InChIKey is MQFGUSXTVQNNNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C6H16N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;7-5-3-1-2-4-6-8/h1-8H,9H2;1-8H2.
What are the key properties of 9H-fluorene;hexane-1,6-diamine?
9H-fluorene;hexane-1,6-diamine has a molecular weight of 282.43 g/mol, XLogP of 3.72, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;hexane-1,6-diamine is sourced from PubChem (CID 19108206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).