About ethane-1,2-diamine;9H-fluorene
ethane-1,2-diamine;9H-fluorene (PubChem CID 159422270) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane-1,2-diamine;9H-fluorene.
Molecular Properties
| Compound Name | ethane-1,2-diamine;9H-fluorene |
| PubChem CID | 159422270 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | ethane-1,2-diamine;9H-fluorene |
| SMILES | NCCN.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C2H8N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;3-1-2-4/h1-8H,9H2;1-4H2 |
| InChIKey | LPXJFRYLUPXQGA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane-1,2-diamine;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;9H-fluorene?
The IUPAC name of ethane-1,2-diamine;9H-fluorene (CID 159422270) is ethane-1,2-diamine;9H-fluorene.
What is the SMILES notation for ethane-1,2-diamine;9H-fluorene?
The canonical SMILES for ethane-1,2-diamine;9H-fluorene is NCCN.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethane-1,2-diamine;9H-fluorene?
The InChIKey is LPXJFRYLUPXQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C2H8N2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;3-1-2-4/h1-8H,9H2;1-4H2.
What are the key properties of ethane-1,2-diamine;9H-fluorene?
ethane-1,2-diamine;9H-fluorene has a molecular weight of 226.32 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;9H-fluorene is sourced from PubChem (CID 159422270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).