About butane-1,4-diol;9H-fluorene
butane-1,4-diol;9H-fluorene (PubChem CID 158933795) has the molecular formula C17H20O2
and a molecular weight of 256.34 g/mol. Its IUPAC name is butane-1,4-diol;9H-fluorene.
Molecular Properties
| Compound Name | butane-1,4-diol;9H-fluorene |
| PubChem CID | 158933795 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | butane-1,4-diol;9H-fluorene |
| SMILES | OCCCCO.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C4H10O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;5-3-1-2-4-6/h1-8H,9H2;5-6H,1-4H2 |
| InChIKey | JJJXWUHGKSCVPB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane-1,4-diol;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,4-diol;9H-fluorene?
The IUPAC name of butane-1,4-diol;9H-fluorene (CID 158933795) is butane-1,4-diol;9H-fluorene.
What is the SMILES notation for butane-1,4-diol;9H-fluorene?
The canonical SMILES for butane-1,4-diol;9H-fluorene is OCCCCO.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of butane-1,4-diol;9H-fluorene?
The InChIKey is JJJXWUHGKSCVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C4H10O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;5-3-1-2-4-6/h1-8H,9H2;5-6H,1-4H2.
What are the key properties of butane-1,4-diol;9H-fluorene?
butane-1,4-diol;9H-fluorene has a molecular weight of 256.34 g/mol, XLogP of 3.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,4-diol;9H-fluorene is sourced from PubChem (CID 158933795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).