About 9H-fluorene;propane-1,2-diol
9H-fluorene;propane-1,2-diol (PubChem CID 158061143) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 9H-fluorene;propane-1,2-diol.
Molecular Properties
| Compound Name | 9H-fluorene;propane-1,2-diol |
| PubChem CID | 158061143 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 9H-fluorene;propane-1,2-diol |
| SMILES | CC(O)CO.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C3H8O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3(5)2-4/h1-8H,9H2;3-5H,2H2,1H3 |
| InChIKey | FKQSHOPJLLGPCL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;propane-1,2-diol?
The IUPAC name of 9H-fluorene;propane-1,2-diol (CID 158061143) is 9H-fluorene;propane-1,2-diol.
What is the SMILES notation for 9H-fluorene;propane-1,2-diol?
The canonical SMILES for 9H-fluorene;propane-1,2-diol is CC(O)CO.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;propane-1,2-diol?
The InChIKey is FKQSHOPJLLGPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H8O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3(5)2-4/h1-8H,9H2;3-5H,2H2,1H3.
What are the key properties of 9H-fluorene;propane-1,2-diol?
9H-fluorene;propane-1,2-diol has a molecular weight of 242.32 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;propane-1,2-diol is sourced from PubChem (CID 158061143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).