About 2,2-diphenoxyethanol;9H-fluorene
2,2-diphenoxyethanol;9H-fluorene (PubChem CID 155169459) has the molecular formula C27H24O3
and a molecular weight of 396.49 g/mol. Its IUPAC name is 2,2-diphenoxyethanol;9H-fluorene.
Molecular Properties
| Compound Name | 2,2-diphenoxyethanol;9H-fluorene |
| PubChem CID | 155169459 |
| Molecular Formula | C27H24O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2,2-diphenoxyethanol;9H-fluorene |
| SMILES | OCC(Oc1ccccc1)Oc1ccccc1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H14O3.C13H10/c15-11-14(16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-10,14-15H,11H2;1-8H,9H2 |
| InChIKey | ISCSIGLZPACZFS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenoxyethanol;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenoxyethanol;9H-fluorene?
The IUPAC name of 2,2-diphenoxyethanol;9H-fluorene (CID 155169459) is 2,2-diphenoxyethanol;9H-fluorene.
What is the SMILES notation for 2,2-diphenoxyethanol;9H-fluorene?
The canonical SMILES for 2,2-diphenoxyethanol;9H-fluorene is OCC(Oc1ccccc1)Oc1ccccc1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 2,2-diphenoxyethanol;9H-fluorene?
The InChIKey is ISCSIGLZPACZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3.C13H10/c15-11-14(16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-10,14-15H,11H2;1-8H,9H2.
What are the key properties of 2,2-diphenoxyethanol;9H-fluorene?
2,2-diphenoxyethanol;9H-fluorene has a molecular weight of 396.49 g/mol, XLogP of 5.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenoxyethanol;9H-fluorene is sourced from PubChem (CID 155169459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).