C17H16O4 — CID 174585361
anthracene-9,10-dione;propane-1,2-diol (PubChem CID 174585361) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is anthracene-9,10-dione;propane-1,2-diol.
| Compound Name | anthracene-9,10-dione;propane-1,2-diol |
|---|---|
| PubChem CID | 174585361 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | anthracene-9,10-dione;propane-1,2-diol |
| SMILES | CC(O)CO.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.C3H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-3(5)2-4/h1-8H;3-5H,2H2,1H3 |
| InChIKey | PXSJRGPCNXLEIZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|