C18H20O4 — CID 159192832
9H-fluoren-1-yl acetate;propane-1,2-diol (PubChem CID 159192832) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 9H-fluoren-1-yl acetate;propane-1,2-diol.
| Compound Name | 9H-fluoren-1-yl acetate;propane-1,2-diol |
|---|---|
| PubChem CID | 159192832 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 9H-fluoren-1-yl acetate;propane-1,2-diol |
| SMILES | CC(=O)Oc1cccc2c1Cc1ccccc1-2.CC(O)CO |
| InChI | InChI=1S/C15H12O2.C3H8O2/c1-10(16)17-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15;1-3(5)2-4/h2-8H,9H2,1H3;3-5H,2H2,1H3 |
| InChIKey | KOHNLVFGUZSEGB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|