C30H22O6 — CID 101363551
bis(9H-fluoren-1-yl) (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 101363551) has the molecular formula C30H22O6 and a molecular weight of 478.50 g/mol. Its IUPAC name is bis(9H-fluoren-1-yl) (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | bis(9H-fluoren-1-yl) (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 101363551 |
| Molecular Formula | C30H22O6 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | bis(9H-fluoren-1-yl) (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | O=C(Oc1cccc2c1Cc1ccccc1-2)[C@H](O)[C@@H](O)C(=O)Oc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C30H22O6/c31-27(29(33)35-25-13-5-11-21-19-9-3-1-7-17(19)15-23(21)25)28(32)30(34)36-26-14-6-12-22-20-10-4-2-8-18(20)16-24(22)26/h1-14,27-28,31-32H,15-16H2/t27-,28-/m1/s1 |
| InChIKey | WLGIPZPXXGUFIK-VSGBNLITSA-N |
| XLogP | 4.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|